C14H16ClN5O3 — CID 112522549
ethyl N-[1-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112522549) has the molecular formula C14H16ClN5O3 and a molecular weight of 337.77 g/mol. Its IUPAC name is ethyl N-[1-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[1-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112522549 |
| Molecular Formula | C14H16ClN5O3 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | ethyl N-[1-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cn(CC(=O)NCc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C14H16ClN5O3/c1-2-23-14(22)17-12-8-20(19-18-12)9-13(21)16-7-10-5-3-4-6-11(10)15/h3-6,8H,2,7,9H2,1H3,(H,16,21)(H,17,22) |
| InChIKey | AFKMLNWLLKZUJT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |