C13H16ClN5O — CID 66214231
N-[(2-chlorophenyl)methyl]-2-[4-(methylaminomethyl)triazol-1-yl]acetamide (PubChem CID 66214231) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[4-(methylaminomethyl)triazol-1-yl]acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[4-(methylaminomethyl)triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 66214231 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[4-(methylaminomethyl)triazol-1-yl]acetamide |
| SMILES | CNCc1cn(CC(=O)NCc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C13H16ClN5O/c1-15-7-11-8-19(18-17-11)9-13(20)16-6-10-4-2-3-5-12(10)14/h2-5,8,15H,6-7,9H2,1H3,(H,16,20) |
| InChIKey | RYMBENHSMGKRDJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |