C12H17N5OS — CID 66215249
2-[4-(methylaminomethyl)triazol-1-yl]-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 66215249) has the molecular formula C12H17N5OS and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-[4-(methylaminomethyl)triazol-1-yl]-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[4-(methylaminomethyl)triazol-1-yl]-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 66215249 |
| Molecular Formula | C12H17N5OS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-[4-(methylaminomethyl)triazol-1-yl]-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CNCc1cn(CC(=O)NC(C)c2cccs2)nn1 |
| InChI | InChI=1S/C12H17N5OS/c1-9(11-4-3-5-19-11)14-12(18)8-17-7-10(6-13-2)15-16-17/h3-5,7,9,13H,6,8H2,1-2H3,(H,14,18) |
| InChIKey | PRYBAPVSZGMWQO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |