C14H15N7O3 — CID 112527924
ethyl N-[1-[2-(3-aminoindazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate (PubChem CID 112527924) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is ethyl N-[1-[2-(3-aminoindazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(3-aminoindazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
|---|---|
| PubChem CID | 112527924 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | ethyl N-[1-[2-(3-aminoindazol-1-yl)-2-oxoethyl]triazol-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1cn(CC(=O)n2nc(N)c3ccccc32)nn1 |
| InChI | InChI=1S/C14H15N7O3/c1-2-24-14(23)16-11-7-20(19-17-11)8-12(22)21-10-6-4-3-5-9(10)13(15)18-21/h3-7H,2,8H2,1H3,(H2,15,18)(H,16,23) |
| InChIKey | OJBBNEKHFJIJKI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |