C12H15N5O3S — CID 65354656
4-amino-1-methyl-N-[(4-sulfamoylphenyl)methyl]pyrazole-3-carboxamide (PubChem CID 65354656) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-amino-1-methyl-N-[(4-sulfamoylphenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-methyl-N-[(4-sulfamoylphenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65354656 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 4-amino-1-methyl-N-[(4-sulfamoylphenyl)methyl]pyrazole-3-carboxamide |
| SMILES | Cn1cc(N)c(C(=O)NCc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C12H15N5O3S/c1-17-7-10(13)11(16-17)12(18)15-6-8-2-4-9(5-3-8)21(14,19)20/h2-5,7H,6,13H2,1H3,(H,15,18)(H2,14,19,20) |
| InChIKey | ZGVYYXXVZURJPA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |