C12H13N3O4S — CID 66335292
4-methyl-N-[(4-sulfamoylphenyl)methyl]-1,2-oxazole-5-carboxamide (PubChem CID 66335292) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-methyl-N-[(4-sulfamoylphenyl)methyl]-1,2-oxazole-5-carboxamide.
| Compound Name | 4-methyl-N-[(4-sulfamoylphenyl)methyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 66335292 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 4-methyl-N-[(4-sulfamoylphenyl)methyl]-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cnoc1C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H13N3O4S/c1-8-6-15-19-11(8)12(16)14-7-9-2-4-10(5-3-9)20(13,17)18/h2-6H,7H2,1H3,(H,14,16)(H2,13,17,18) |
| InChIKey | NLGUSEOUMHDXQH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |