C15H17N3O4S — CID 146043450
5-methoxy-2-methyl-N-[(4-sulfamoylphenyl)methyl]pyridine-4-carboxamide (PubChem CID 146043450) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 5-methoxy-2-methyl-N-[(4-sulfamoylphenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 5-methoxy-2-methyl-N-[(4-sulfamoylphenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 146043450 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-methoxy-2-methyl-N-[(4-sulfamoylphenyl)methyl]pyridine-4-carboxamide |
| SMILES | COc1cnc(C)cc1C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H17N3O4S/c1-10-7-13(14(22-2)9-17-10)15(19)18-8-11-3-5-12(6-4-11)23(16,20)21/h3-7,9H,8H2,1-2H3,(H,18,19)(H2,16,20,21) |
| InChIKey | UKXUPILHAWHGBE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |