C23H22N2O6S — CID 171979954
4-benzoyl-2,5-dimethoxy-N-[(4-sulfamoylphenyl)methyl]benzamide (PubChem CID 171979954) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is 4-benzoyl-2,5-dimethoxy-N-[(4-sulfamoylphenyl)methyl]benzamide.
| Compound Name | 4-benzoyl-2,5-dimethoxy-N-[(4-sulfamoylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 171979954 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 4-benzoyl-2,5-dimethoxy-N-[(4-sulfamoylphenyl)methyl]benzamide |
| SMILES | COc1cc(C(=O)c2ccccc2)c(OC)cc1C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H22N2O6S/c1-30-20-13-19(21(31-2)12-18(20)22(26)16-6-4-3-5-7-16)23(27)25-14-15-8-10-17(11-9-15)32(24,28)29/h3-13H,14H2,1-2H3,(H,25,27)(H2,24,28,29) |
| InChIKey | ABDGMVARDVIKOY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |