C21H26F2N4O3S — CID 26574101
2-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide (PubChem CID 26574101) has the molecular formula C21H26F2N4O3S and a molecular weight of 452.53 g/mol. Its IUPAC name is 2-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide.
| Compound Name | 2-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 26574101 |
| Molecular Formula | C21H26F2N4O3S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
| SMILES | CN(C)c1ccc(CNC(=O)CN2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H26F2N4O3S/c1-25(2)17-5-3-16(4-6-17)14-24-21(28)15-26-9-11-27(12-10-26)31(29,30)18-7-8-19(22)20(23)13-18/h3-8,13H,9-12,14-15H2,1-2H3,(H,24,28) |
| InChIKey | NWKLOADRGARGNX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|