C19H20N2O3S2 — CID 126212127
N-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1,3-thiazol-2-ylidene]benzenesulfonamide (PubChem CID 126212127) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1,3-thiazol-2-ylidene]benzenesulfonamide.
| Compound Name | N-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1,3-thiazol-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 126212127 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1,3-thiazol-2-ylidene]benzenesulfonamide |
| SMILES | CCc1sc(=NS(=O)(=O)c2ccccc2)n(C)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H20N2O3S2/c1-4-17-18(14-10-12-15(24-3)13-11-14)21(2)19(25-17)20-26(22,23)16-8-6-5-7-9-16/h5-13H,4H2,1-3H3 |
| InChIKey | QWECLVXKSUYWNI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|