C15H14N4O3S2 — CID 15697867
(NZ)-N-(4-benzylthiatriazol-5-ylidene)-4-methoxybenzenesulfonamide (PubChem CID 15697867) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is (NZ)-N-(4-benzylthiatriazol-5-ylidene)-4-methoxybenzenesulfonamide.
| Compound Name | (NZ)-N-(4-benzylthiatriazol-5-ylidene)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 15697867 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (NZ)-N-(4-benzylthiatriazol-5-ylidene)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)/N=c2\snnn2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C15H14N4O3S2/c1-22-13-7-9-14(10-8-13)24(20,21)16-15-19(17-18-23-15)11-12-5-3-2-4-6-12/h2-10H,11H2,1H3/b16-15- |
| InChIKey | UHIFFEBNRPUIHV-NXVVXOECSA-N |
| XLogP | 1.69 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |