C16H17ClFNOS — CID 69321127
(2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(5-chloro-2-fluorophenyl)ethanone (PubChem CID 69321127) has the molecular formula C16H17ClFNOS and a molecular weight of 325.84 g/mol. Its IUPAC name is (2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(5-chloro-2-fluorophenyl)ethanone.
| Compound Name | (2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(5-chloro-2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 69321127 |
| Molecular Formula | C16H17ClFNOS |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(5-chloro-2-fluorophenyl)ethanone |
| SMILES | CCCCN1C(C)=CS/C1=C\C(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H17ClFNOS/c1-3-4-7-19-11(2)10-21-16(19)9-15(20)13-8-12(17)5-6-14(13)18/h5-6,8-10H,3-4,7H2,1-2H3/b16-9- |
| InChIKey | GXKDUOCUJIPLFK-SXGWCWSVSA-N |
| XLogP | 5.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|