C17H20FNOS — CID 69324003
(2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(5-fluoro-2-methylphenyl)ethanone (PubChem CID 69324003) has the molecular formula C17H20FNOS and a molecular weight of 305.42 g/mol. Its IUPAC name is (2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(5-fluoro-2-methylphenyl)ethanone.
| Compound Name | (2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(5-fluoro-2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 69324003 |
| Molecular Formula | C17H20FNOS |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2Z)-2-(3-butyl-4-methyl-1,3-thiazol-2-ylidene)-1-(5-fluoro-2-methylphenyl)ethanone |
| SMILES | CCCCN1C(C)=CS/C1=C\C(=O)c1cc(F)ccc1C |
| InChI | InChI=1S/C17H20FNOS/c1-4-5-8-19-13(3)11-21-17(19)10-16(20)15-9-14(18)7-6-12(15)2/h6-7,9-11H,4-5,8H2,1-3H3/b17-10- |
| InChIKey | OKUNAZOVLGBASD-YVLHZVERSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|