C21H20FNO2 — CID 139227637
(3E)-1-butyl-5-fluoro-3-[2-(4-methylphenyl)-2-oxoethylidene]indol-2-one (PubChem CID 139227637) has the molecular formula C21H20FNO2 and a molecular weight of 337.39 g/mol. Its IUPAC name is (3E)-1-butyl-5-fluoro-3-[2-(4-methylphenyl)-2-oxoethylidene]indol-2-one.
| Compound Name | (3E)-1-butyl-5-fluoro-3-[2-(4-methylphenyl)-2-oxoethylidene]indol-2-one |
|---|---|
| PubChem CID | 139227637 |
| Molecular Formula | C21H20FNO2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (3E)-1-butyl-5-fluoro-3-[2-(4-methylphenyl)-2-oxoethylidene]indol-2-one |
| SMILES | CCCCN1C(=O)/C(=C/C(=O)c2ccc(C)cc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C21H20FNO2/c1-3-4-11-23-19-10-9-16(22)12-17(19)18(21(23)25)13-20(24)15-7-5-14(2)6-8-15/h5-10,12-13H,3-4,11H2,1-2H3/b18-13+ |
| InChIKey | YJEHAWMGDYYFQZ-QGOAFFKASA-N |
| XLogP | 4.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|