About 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione
2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione (PubChem CID 167513160) has the molecular formula C17H19FN2O4
and a molecular weight of 334.35 g/mol. Its IUPAC name is 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione.
Molecular Properties
| Compound Name | 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione |
| PubChem CID | 167513160 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione |
| SMILES | CCCCN1C(=O)c2ccc(F)cc2C1=O.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C12H12FNO2.C5H7NO2/c1-2-3-6-14-11(15)9-5-4-8(13)7-10(9)12(14)16;7-4-2-1-3-5(8)6-4/h4-5,7H,2-3,6H2,1H3;1-3H2,(H,6,7,8) |
| InChIKey | GJTWBDDVCPRCCP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione?
The IUPAC name of 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione (CID 167513160) is 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione.
What is the SMILES notation for 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione?
The canonical SMILES for 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione is CCCCN1C(=O)c2ccc(F)cc2C1=O.O=C1CCCC(=O)N1.
What is the InChIKey of 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione?
The InChIKey is GJTWBDDVCPRCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO2.C5H7NO2/c1-2-3-6-14-11(15)9-5-4-8(13)7-10(9)12(14)16;7-4-2-1-3-5(8)6-4/h4-5,7H,2-3,6H2,1H3;1-3H2,(H,6,7,8).
What are the key properties of 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione?
2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione has a molecular weight of 334.35 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5-fluoroisoindole-1,3-dione;piperidine-2,6-dione is sourced from PubChem (CID 167513160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).