C18H26N2O2 — CID 132514130
5-amino-2-decylisoindole-1,3-dione (PubChem CID 132514130) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-amino-2-decylisoindole-1,3-dione.
| Compound Name | 5-amino-2-decylisoindole-1,3-dione |
|---|---|
| PubChem CID | 132514130 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 5-amino-2-decylisoindole-1,3-dione |
| SMILES | CCCCCCCCCCN1C(=O)c2ccc(N)cc2C1=O |
| InChI | InChI=1S/C18H26N2O2/c1-2-3-4-5-6-7-8-9-12-20-17(21)15-11-10-14(19)13-16(15)18(20)22/h10-11,13H,2-9,12,19H2,1H3 |
| InChIKey | QHOIGYVOEZHSJP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|