C40H42N4O4 — CID 101466482
2,5-bis(2-octyl-1,3-dioxoisoindol-5-yl)benzene-1,4-dicarbonitrile (PubChem CID 101466482) has the molecular formula C40H42N4O4 and a molecular weight of 642.80 g/mol. Its IUPAC name is 2,5-bis(2-octyl-1,3-dioxoisoindol-5-yl)benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis(2-octyl-1,3-dioxoisoindol-5-yl)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 101466482 |
| Molecular Formula | C40H42N4O4 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | 2,5-bis(2-octyl-1,3-dioxoisoindol-5-yl)benzene-1,4-dicarbonitrile |
| SMILES | CCCCCCCCN1C(=O)c2ccc(-c3cc(C#N)c(-c4ccc5c(c4)C(=O)N(CCCCCCCC)C5=O)cc3C#N)cc2C1=O |
| InChI | InChI=1S/C40H42N4O4/c1-3-5-7-9-11-13-19-43-37(45)31-17-15-27(21-35(31)39(43)47)33-23-30(26-42)34(24-29(33)25-41)28-16-18-32-36(22-28)40(48)44(38(32)46)20-14-12-10-8-6-4-2/h15-18,21-24H,3-14,19-20H2,1-2H3 |
| InChIKey | YEGHBVZKECBXRW-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 122.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|