C34H32N2O4S2 — CID 132566520
5-[5-[5-(1,3-dioxo-2-pentylisoindol-5-yl)thiophen-2-yl]thiophen-2-yl]-2-pentylisoindole-1,3-dione (PubChem CID 132566520) has the molecular formula C34H32N2O4S2 and a molecular weight of 596.77 g/mol. Its IUPAC name is 5-[5-[5-(1,3-dioxo-2-pentylisoindol-5-yl)thiophen-2-yl]thiophen-2-yl]-2-pentylisoindole-1,3-dione.
| Compound Name | 5-[5-[5-(1,3-dioxo-2-pentylisoindol-5-yl)thiophen-2-yl]thiophen-2-yl]-2-pentylisoindole-1,3-dione |
|---|---|
| PubChem CID | 132566520 |
| Molecular Formula | C34H32N2O4S2 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | 5-[5-[5-(1,3-dioxo-2-pentylisoindol-5-yl)thiophen-2-yl]thiophen-2-yl]-2-pentylisoindole-1,3-dione |
| SMILES | CCCCCN1C(=O)c2ccc(-c3ccc(-c4ccc(-c5ccc6c(c5)C(=O)N(CCCCC)C6=O)s4)s3)cc2C1=O |
| InChI | InChI=1S/C34H32N2O4S2/c1-3-5-7-17-35-31(37)23-11-9-21(19-25(23)33(35)39)27-13-15-29(41-27)30-16-14-28(42-30)22-10-12-24-26(20-22)34(40)36(32(24)38)18-8-6-4-2/h9-16,19-20H,3-8,17-18H2,1-2H3 |
| InChIKey | LBPTZWUBNKIRCU-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|