C17H22FNO2 — CID 3089281
5-fluoro-2-nonylisoindole-1,3-dione (PubChem CID 3089281) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is 5-fluoro-2-nonylisoindole-1,3-dione.
| Compound Name | 5-fluoro-2-nonylisoindole-1,3-dione |
|---|---|
| PubChem CID | 3089281 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-fluoro-2-nonylisoindole-1,3-dione |
| SMILES | CCCCCCCCCN1C(=O)c2ccc(F)cc2C1=O |
| InChI | InChI=1S/C17H22FNO2/c1-2-3-4-5-6-7-8-11-19-16(20)14-10-9-13(18)12-15(14)17(19)21/h9-10,12H,2-8,11H2,1H3 |
| InChIKey | PRZPELWUUYCLPD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|