C11H7FNO4- — CID 3305675
3-(5-fluoro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3305675) has the molecular formula C11H7FNO4- and a molecular weight of 236.18 g/mol. Its IUPAC name is 3-(5-fluoro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 3-(5-fluoro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3305675 |
| Molecular Formula | C11H7FNO4- |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(5-fluoro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C([O-])CCN1C(=O)c2ccc(F)cc2C1=O |
| InChI | InChI=1S/C11H8FNO4/c12-6-1-2-7-8(5-6)11(17)13(10(7)16)4-3-9(14)15/h1-2,5H,3-4H2,(H,14,15)/p-1 |
| InChIKey | JLSUYUIARWVWKZ-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|