C19H13FNO4- — CID 9041575
3-[(4Z)-4-[(3-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoate (PubChem CID 9041575) has the molecular formula C19H13FNO4- and a molecular weight of 338.31 g/mol. Its IUPAC name is 3-[(4Z)-4-[(3-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoate.
| Compound Name | 3-[(4Z)-4-[(3-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoate |
|---|---|
| PubChem CID | 9041575 |
| Molecular Formula | C19H13FNO4- |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-[(4Z)-4-[(3-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoate |
| SMILES | O=C([O-])CCN1C(=O)/C(=C\c2cccc(F)c2)c2ccccc2C1=O |
| InChI | InChI=1S/C19H14FNO4/c20-13-5-3-4-12(10-13)11-16-14-6-1-2-7-15(14)18(24)21(19(16)25)9-8-17(22)23/h1-7,10-11H,8-9H2,(H,22,23)/p-1/b16-11- |
| InChIKey | HELDEDDTODPPGW-WJDWOHSUSA-M |
| XLogP | 1.49 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|