C25H18FNO4 — CID 7972427
ethyl 4-[(4Z)-4-[(3-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]benzoate (PubChem CID 7972427) has the molecular formula C25H18FNO4 and a molecular weight of 415.42 g/mol. Its IUPAC name is ethyl 4-[(4Z)-4-[(3-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]benzoate.
| Compound Name | ethyl 4-[(4Z)-4-[(3-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 7972427 |
| Molecular Formula | C25H18FNO4 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | ethyl 4-[(4Z)-4-[(3-fluorophenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)/C(=C\c3cccc(F)c3)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H18FNO4/c1-2-31-25(30)17-10-12-19(13-11-17)27-23(28)21-9-4-3-8-20(21)22(24(27)29)15-16-6-5-7-18(26)14-16/h3-15H,2H2,1H3/b22-15- |
| InChIKey | NPMVHYBUVRRHQB-JCMHNJIXSA-N |
| XLogP | 4.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|