C19H14NO6- — CID 9367852
2-[(4Z)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate (PubChem CID 9367852) has the molecular formula C19H14NO6- and a molecular weight of 352.32 g/mol. Its IUPAC name is 2-[(4Z)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate.
| Compound Name | 2-[(4Z)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 9367852 |
| Molecular Formula | C19H14NO6- |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-[(4Z)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
| SMILES | COc1ccc(/C=C2\C(=O)N(CC(=O)[O-])C(=O)c3ccccc32)cc1O |
| InChI | InChI=1S/C19H15NO6/c1-26-16-7-6-11(9-15(16)21)8-14-12-4-2-3-5-13(12)18(24)20(19(14)25)10-17(22)23/h2-9,21H,10H2,1H3,(H,22,23)/p-1/b14-8- |
| InChIKey | WVKIZRYNNGTWFV-ZSOIEALJSA-M |
| XLogP | 0.67 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|