C24H24NO6- — CID 9367943
2-[(4Z)-4-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetate (PubChem CID 9367943) has the molecular formula C24H24NO6- and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-[(4Z)-4-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetate.
| Compound Name | 2-[(4Z)-4-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 9367943 |
| Molecular Formula | C24H24NO6- |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[(4Z)-4-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-1,3-dioxoisoquinolin-2-yl]acetate |
| SMILES | CCOc1cc(/C=C2\C(=O)N(CC(=O)[O-])C(=O)c3ccccc32)ccc1OCC(C)C |
| InChI | InChI=1S/C24H25NO6/c1-4-30-21-12-16(9-10-20(21)31-14-15(2)3)11-19-17-7-5-6-8-18(17)23(28)25(24(19)29)13-22(26)27/h5-12,15H,4,13-14H2,1-3H3,(H,26,27)/p-1/b19-11- |
| InChIKey | BTFPQVYRMWGRRJ-ODLFYWEKSA-M |
| XLogP | 2.39 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|