C20H23N2O6S- — CID 7312133
(2S)-2-[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]propanoate (PubChem CID 7312133) has the molecular formula C20H23N2O6S- and a molecular weight of 419.48 g/mol. Its IUPAC name is (2S)-2-[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]propanoate.
| Compound Name | (2S)-2-[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 7312133 |
| Molecular Formula | C20H23N2O6S- |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | (2S)-2-[4-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxyphenoxy]propanoate |
| SMILES | CCOc1cc(C=C2C(=O)N(CC)C(=S)N(CC)C2=O)ccc1O[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C20H24N2O6S/c1-5-21-17(23)14(18(24)22(6-2)20(21)29)10-13-8-9-15(16(11-13)27-7-3)28-12(4)19(25)26/h8-12H,5-7H2,1-4H3,(H,25,26)/p-1/t12-/m0/s1 |
| InChIKey | RDFIZUVNHBCRQY-LBPRGKRZSA-M |
| XLogP | 0.98 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|