C21H19ClN2O7S3 — CID 43863361
2-[4-[(E)-[3-[(4-chlorophenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid (PubChem CID 43863361) has the molecular formula C21H19ClN2O7S3 and a molecular weight of 543.04 g/mol. Its IUPAC name is 2-[4-[(E)-[3-[(4-chlorophenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid.
| Compound Name | 2-[4-[(E)-[3-[(4-chlorophenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 43863361 |
| Molecular Formula | C21H19ClN2O7S3 |
| Molecular Weight | 543.04 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | 2-[4-[(E)-[3-[(4-chlorophenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NS(=O)(=O)c3ccc(Cl)cc3)C2=O)ccc1OC(C)C(=O)O |
| InChI | InChI=1S/C21H19ClN2O7S3/c1-3-30-17-10-13(4-9-16(17)31-12(2)20(26)27)11-18-19(25)24(21(32)33-18)23-34(28,29)15-7-5-14(22)6-8-15/h4-12,23H,3H2,1-2H3,(H,26,27)/b18-11+ |
| InChIKey | PMJUYRJRLKJFOU-WOJGMQOQSA-N |
| XLogP | 3.69 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.04 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|