C22H22N2O7S3 — CID 43862988
2-[2-methoxy-4-[(E)-[3-[(4-methylphenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid (PubChem CID 43862988) has the molecular formula C22H22N2O7S3 and a molecular weight of 522.63 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-[3-[(4-methylphenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-methoxy-4-[(E)-[3-[(4-methylphenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 43862988 |
| Molecular Formula | C22H22N2O7S3 |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-[3-[(4-methylphenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(/C=C2/SC(=S)N(NS(=O)(=O)c3ccc(C)cc3)C2=O)cc1OC)C(=O)O |
| InChI | InChI=1S/C22H22N2O7S3/c1-4-16(21(26)27)31-17-10-7-14(11-18(17)30-3)12-19-20(25)24(22(32)33-19)23-34(28,29)15-8-5-13(2)6-9-15/h5-12,16,23H,4H2,1-3H3,(H,26,27)/b19-12+ |
| InChIKey | XKXVBFRNAAPOJJ-XDHOZWIPSA-N |
| XLogP | 3.34 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|