C20H17ClN2O6S3 — CID 43862060
2-[4-[(E)-[3-[(4-chlorophenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid (PubChem CID 43862060) has the molecular formula C20H17ClN2O6S3 and a molecular weight of 513.02 g/mol. Its IUPAC name is 2-[4-[(E)-[3-[(4-chlorophenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid.
| Compound Name | 2-[4-[(E)-[3-[(4-chlorophenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 43862060 |
| Molecular Formula | C20H17ClN2O6S3 |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | 2-[4-[(E)-[3-[(4-chlorophenyl)sulfonylamino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(/C=C2/SC(=S)N(NS(=O)(=O)c3ccc(Cl)cc3)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C20H17ClN2O6S3/c1-2-16(19(25)26)29-14-7-3-12(4-8-14)11-17-18(24)23(20(30)31-17)22-32(27,28)15-9-5-13(21)6-10-15/h3-11,16,22H,2H2,1H3,(H,25,26)/b17-11+ |
| InChIKey | IFZPKBLLKATUPB-GZTJUZNOSA-N |
| XLogP | 3.68 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|