C18H17NO8S2 — CID 43861469
2-[(5Z)-5-[[4-(1-carboxypropoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid (PubChem CID 43861469) has the molecular formula C18H17NO8S2 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-(1-carboxypropoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid.
| Compound Name | 2-[(5Z)-5-[[4-(1-carboxypropoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 43861469 |
| Molecular Formula | C18H17NO8S2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 2-[(5Z)-5-[[4-(1-carboxypropoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
| SMILES | CCC(Oc1ccc(/C=C2\SC(=S)N(C(CC(=O)O)C(=O)O)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C18H17NO8S2/c1-2-12(17(25)26)27-10-5-3-9(4-6-10)7-13-15(22)19(18(28)29-13)11(16(23)24)8-14(20)21/h3-7,11-12H,2,8H2,1H3,(H,20,21)(H,23,24)(H,25,26)/b13-7- |
| InChIKey | OXIKPEJIBQUMGY-QPEQYQDCSA-N |
| XLogP | 2.06 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|