C22H17ClF3NO5S2 — CID 43863324
2-[4-[(E)-[3-[4-chloro-2-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid (PubChem CID 43863324) has the molecular formula C22H17ClF3NO5S2 and a molecular weight of 531.96 g/mol. Its IUPAC name is 2-[4-[(E)-[3-[4-chloro-2-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid.
| Compound Name | 2-[4-[(E)-[3-[4-chloro-2-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 43863324 |
| Molecular Formula | C22H17ClF3NO5S2 |
| Molecular Weight | 531.96 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | 2-[4-[(E)-[3-[4-chloro-2-(trifluoromethyl)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(c3ccc(Cl)cc3C(F)(F)F)C2=O)ccc1OC(C)C(=O)O |
| InChI | InChI=1S/C22H17ClF3NO5S2/c1-3-31-17-8-12(4-7-16(17)32-11(2)20(29)30)9-18-19(28)27(21(33)34-18)15-6-5-13(23)10-14(15)22(24,25)26/h4-11H,3H2,1-2H3,(H,29,30)/b18-9+ |
| InChIKey | BMYGBHFTULJWIF-GIJQJNRQSA-N |
| XLogP | 6.02 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.96 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|