C23H23NO7S — CID 43863383
2-[2-ethoxy-4-[(E)-[3-(4-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 43863383) has the molecular formula C23H23NO7S and a molecular weight of 457.50 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[3-(4-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[2-ethoxy-4-[(E)-[3-(4-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 43863383 |
| Molecular Formula | C23H23NO7S |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[3-(4-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | CCOc1ccc(N2C(=O)S/C(=C/c3ccc(OC(C)C(=O)O)c(OCC)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H23NO7S/c1-4-29-17-9-7-16(8-10-17)24-21(25)20(32-23(24)28)13-15-6-11-18(19(12-15)30-5-2)31-14(3)22(26)27/h6-14H,4-5H2,1-3H3,(H,26,27)/b20-13+ |
| InChIKey | DBEBXOIANZXIJA-DEDYPNTBSA-N |
| XLogP | 4.58 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|