C20H17NO6S — CID 43863162
2-[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 43863162) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is 2-[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | 2-[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 43863162 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 2-[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(/C=C2/SC(=O)N(c3ccccc3)C2=O)ccc1OC(C)C(=O)O |
| InChI | InChI=1S/C20H17NO6S/c1-12(19(23)24)27-15-9-8-13(10-16(15)26-2)11-17-18(22)21(20(25)28-17)14-6-4-3-5-7-14/h3-12H,1-2H3,(H,23,24)/b17-11+ |
| InChIKey | VZGSUUYGLOVQME-GZTJUZNOSA-N |
| XLogP | 3.79 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|