C19H15NO5S — CID 43862629
2-[2-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid (PubChem CID 43862629) has the molecular formula C19H15NO5S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[2-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid.
| Compound Name | 2-[2-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 43862629 |
| Molecular Formula | C19H15NO5S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-[2-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccccc1/C=C1/SC(=O)N(c2ccccc2)C1=O)C(=O)O |
| InChI | InChI=1S/C19H15NO5S/c1-12(18(22)23)25-15-10-6-5-7-13(15)11-16-17(21)20(19(24)26-16)14-8-3-2-4-9-14/h2-12H,1H3,(H,22,23)/b16-11+ |
| InChIKey | ZNFHHIWFQHPJTI-LFIBNONCSA-N |
| XLogP | 3.78 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|