C28H27NO4S — CID 50873207
(5E)-5-[[2-[2-(4-tert-butylphenoxy)ethoxy]phenyl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione (PubChem CID 50873207) has the molecular formula C28H27NO4S and a molecular weight of 473.59 g/mol. Its IUPAC name is (5E)-5-[[2-[2-(4-tert-butylphenoxy)ethoxy]phenyl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[2-(4-tert-butylphenoxy)ethoxy]phenyl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 50873207 |
| Molecular Formula | C28H27NO4S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (5E)-5-[[2-[2-(4-tert-butylphenoxy)ethoxy]phenyl]methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)(C)c1ccc(OCCOc2ccccc2/C=C2/SC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C28H27NO4S/c1-28(2,3)21-13-15-23(16-14-21)32-17-18-33-24-12-8-7-9-20(24)19-25-26(30)29(27(31)34-25)22-10-5-4-6-11-22/h4-16,19H,17-18H2,1-3H3/b25-19+ |
| InChIKey | NVRMNPBCYLMWBH-NCELDCMTSA-N |
| XLogP | 6.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|