C21H19NO6S — CID 50873189
ethyl 2-[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetate (PubChem CID 50873189) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 50873189 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | ethyl 2-[4-[(E)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2/SC(=O)N(c3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H19NO6S/c1-3-27-19(23)13-28-16-10-9-14(11-17(16)26-2)12-18-20(24)22(21(25)29-18)15-7-5-4-6-8-15/h4-12H,3,13H2,1-2H3/b18-12+ |
| InChIKey | OLNBQOYSWYBQQY-LDADJPATSA-N |
| XLogP | 3.88 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|