C21H18ClNO6S — CID 1231666
ethyl 2-[4-[(Z)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 1231666) has the molecular formula C21H18ClNO6S and a molecular weight of 447.90 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(Z)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 1231666 |
| Molecular Formula | C21H18ClNO6S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | ethyl 2-[4-[(Z)-[3-(4-chlorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2\SC(=O)N(c3ccc(Cl)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H18ClNO6S/c1-3-28-19(24)12-29-16-9-4-13(10-17(16)27-2)11-18-20(25)23(21(26)30-18)15-7-5-14(22)6-8-15/h4-11H,3,12H2,1-2H3/b18-11- |
| InChIKey | GYOIZNGUNQHUGV-WQRHYEAKSA-N |
| XLogP | 4.53 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|