C19H17NO5S — CID 2022309
(5E)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-3-(4-hydroxyphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 2022309) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is (5E)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-3-(4-hydroxyphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-3-(4-hydroxyphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2022309 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (5E)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]-3-(4-hydroxyphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1ccc(/C=C2/SC(=O)N(c3ccc(O)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C19H17NO5S/c1-3-25-15-9-4-12(10-16(15)24-2)11-17-18(22)20(19(23)26-17)13-5-7-14(21)8-6-13/h4-11,21H,3H2,1-2H3/b17-11+ |
| InChIKey | KDHMIHALWSSLPX-GZTJUZNOSA-N |
| XLogP | 4.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|