C25H27NO6S — CID 43863630
3-[4-[(E)-[3-(4-butan-2-ylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid (PubChem CID 43863630) has the molecular formula C25H27NO6S and a molecular weight of 469.56 g/mol. Its IUPAC name is 3-[4-[(E)-[3-(4-butan-2-ylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid.
| Compound Name | 3-[4-[(E)-[3-(4-butan-2-ylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 43863630 |
| Molecular Formula | C25H27NO6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 3-[4-[(E)-[3-(4-butan-2-ylphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]propanoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(c3ccc(C(C)CC)cc3)C2=O)ccc1OCCC(=O)O |
| InChI | InChI=1S/C25H27NO6S/c1-4-16(3)18-7-9-19(10-8-18)26-24(29)22(33-25(26)30)15-17-6-11-20(21(14-17)31-5-2)32-13-12-23(27)28/h6-11,14-16H,4-5,12-13H2,1-3H3,(H,27,28)/b22-15+ |
| InChIKey | AMCFOWIHHNEDQB-PXLXIMEGSA-N |
| XLogP | 5.69 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|