C22H21NO7S — CID 27418580
3-[4-[(E)-[3-(2-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 27418580) has the molecular formula C22H21NO7S and a molecular weight of 443.48 g/mol. Its IUPAC name is 3-[4-[(E)-[3-(2-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | 3-[4-[(E)-[3-(2-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 27418580 |
| Molecular Formula | C22H21NO7S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 3-[4-[(E)-[3-(2-ethoxyphenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | CCOc1ccccc1N1C(=O)S/C(=C/c2ccc(OCCC(=O)O)c(OC)c2)C1=O |
| InChI | InChI=1S/C22H21NO7S/c1-3-29-16-7-5-4-6-15(16)23-21(26)19(31-22(23)27)13-14-8-9-17(18(12-14)28-2)30-11-10-20(24)25/h4-9,12-13H,3,10-11H2,1-2H3,(H,24,25)/b19-13+ |
| InChIKey | JFRWFLDHLKWBPB-CPNJWEJPSA-N |
| XLogP | 4.19 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|