C20H16FNO6S — CID 27418596
3-[4-[(E)-[3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 27418596) has the molecular formula C20H16FNO6S and a molecular weight of 417.41 g/mol. Its IUPAC name is 3-[4-[(E)-[3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | 3-[4-[(E)-[3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 27418596 |
| Molecular Formula | C20H16FNO6S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 3-[4-[(E)-[3-(4-fluorophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(/C=C2/SC(=O)N(c3ccc(F)cc3)C2=O)ccc1OCCC(=O)O |
| InChI | InChI=1S/C20H16FNO6S/c1-27-16-10-12(2-7-15(16)28-9-8-18(23)24)11-17-19(25)22(20(26)29-17)14-5-3-13(21)4-6-14/h2-7,10-11H,8-9H2,1H3,(H,23,24)/b17-11+ |
| InChIKey | AVEZSASVOPRLOT-GZTJUZNOSA-N |
| XLogP | 3.93 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|