C24H23N2O6S- — CID 2243969
(2S)-2-[2-ethoxy-4-[(E)-[1-(2-ethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoate (PubChem CID 2243969) has the molecular formula C24H23N2O6S- and a molecular weight of 467.52 g/mol. Its IUPAC name is (2S)-2-[2-ethoxy-4-[(E)-[1-(2-ethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoate.
| Compound Name | (2S)-2-[2-ethoxy-4-[(E)-[1-(2-ethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 2243969 |
| Molecular Formula | C24H23N2O6S- |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (2S)-2-[2-ethoxy-4-[(E)-[1-(2-ethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoate |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=S)N(c3ccccc3CC)C2=O)ccc1O[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C24H24N2O6S/c1-4-16-8-6-7-9-18(16)26-22(28)17(21(27)25-24(26)33)12-15-10-11-19(20(13-15)31-5-2)32-14(3)23(29)30/h6-14H,4-5H2,1-3H3,(H,29,30)(H,25,27,33)/p-1/b17-12+/t14-/m0/s1 |
| InChIKey | JSXMJFPMOCAMOT-IQGJIOQQSA-M |
| XLogP | 2.00 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|