C21H16FN2O6S- — CID 2177052
(2R)-2-[4-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]propanoate (PubChem CID 2177052) has the molecular formula C21H16FN2O6S- and a molecular weight of 443.43 g/mol. Its IUPAC name is (2R)-2-[4-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]propanoate.
| Compound Name | (2R)-2-[4-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 2177052 |
| Molecular Formula | C21H16FN2O6S- |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | (2R)-2-[4-[(E)-[1-(2-fluorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]propanoate |
| SMILES | COc1cc(/C=C2\C(=O)NC(=S)N(c3ccccc3F)C2=O)ccc1O[C@H](C)C(=O)[O-] |
| InChI | InChI=1S/C21H17FN2O6S/c1-11(20(27)28)30-16-8-7-12(10-17(16)29-2)9-13-18(25)23-21(31)24(19(13)26)15-6-4-3-5-14(15)22/h3-11H,1-2H3,(H,27,28)(H,23,25,31)/p-1/b13-9+/t11-/m1/s1 |
| InChIKey | VYFPHMFAAXSXCZ-VSXLWIIGSA-M |
| XLogP | 1.18 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|