C22H19N2O5S- — CID 2279157
(2S)-2-[4-[(Z)-[1-(2,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoate (PubChem CID 2279157) has the molecular formula C22H19N2O5S- and a molecular weight of 423.47 g/mol. Its IUPAC name is (2S)-2-[4-[(Z)-[1-(2,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoate.
| Compound Name | (2S)-2-[4-[(Z)-[1-(2,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 2279157 |
| Molecular Formula | C22H19N2O5S- |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (2S)-2-[4-[(Z)-[1-(2,4-dimethylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]propanoate |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3ccc(O[C@@H](C)C(=O)[O-])cc3)C(=O)NC2=S)c(C)c1 |
| InChI | InChI=1S/C22H20N2O5S/c1-12-4-9-18(13(2)10-12)24-20(26)17(19(25)23-22(24)30)11-15-5-7-16(8-6-15)29-14(3)21(27)28/h4-11,14H,1-3H3,(H,27,28)(H,23,25,30)/p-1/b17-11-/t14-/m0/s1 |
| InChIKey | ZTORDMOINPMZIK-FMNVXAMXSA-M |
| XLogP | 1.65 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|