C17H15N2O5S- — CID 2287206
(2S)-2-[4-[(E)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]propanoate (PubChem CID 2287206) has the molecular formula C17H15N2O5S- and a molecular weight of 359.38 g/mol. Its IUPAC name is (2S)-2-[4-[(E)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]propanoate.
| Compound Name | (2S)-2-[4-[(E)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 2287206 |
| Molecular Formula | C17H15N2O5S- |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | (2S)-2-[4-[(E)-(4,6-dioxo-1-prop-2-enyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]propanoate |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(O[C@@H](C)C(=O)[O-])cc2)C(=O)NC1=S |
| InChI | InChI=1S/C17H16N2O5S/c1-3-8-19-15(21)13(14(20)18-17(19)25)9-11-4-6-12(7-5-11)24-10(2)16(22)23/h3-7,9-10H,1,8H2,2H3,(H,22,23)(H,18,20,25)/p-1/b13-9+/t10-/m0/s1 |
| InChIKey | HVBGZJIQUKXTPI-YWEFTTLKSA-M |
| XLogP | 0.02 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|