C25H28N2O5S — CID 3481795
methyl 2-[5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 3481795) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is methyl 2-[5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 3481795 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | methyl 2-[5-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methylidene]-4-oxo-3-phenyl-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOc1cc(C=C2C(=O)N(c3ccccc3)C(=S)N2CC(=O)OC)ccc1OCC(C)C |
| InChI | InChI=1S/C25H28N2O5S/c1-5-31-22-14-18(11-12-21(22)32-16-17(2)3)13-20-24(29)27(19-9-7-6-8-10-19)25(33)26(20)15-23(28)30-4/h6-14,17H,5,15-16H2,1-4H3 |
| InChIKey | FYMUZQJDXLYKQA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|