C30H29FN2O5S — CID 3725729
methyl 2-[5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 3725729) has the molecular formula C30H29FN2O5S and a molecular weight of 548.64 g/mol. Its IUPAC name is methyl 2-[5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 3725729 |
| Molecular Formula | C30H29FN2O5S |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | methyl 2-[5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOc1cc(C=C2C(=O)N(c3ccc(CC)cc3)C(=S)N2CC(=O)OC)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C30H29FN2O5S/c1-4-20-10-13-23(14-11-20)33-29(35)25(32(30(33)39)18-28(34)36-3)16-21-12-15-26(27(17-21)37-5-2)38-19-22-8-6-7-9-24(22)31/h6-17H,4-5,18-19H2,1-3H3 |
| InChIKey | VGCDJCILQFDLHK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|