C28H25FN2O4S — CID 126067028
methyl 2-[(5Z)-3-(4-ethylphenyl)-5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126067028) has the molecular formula C28H25FN2O4S and a molecular weight of 504.58 g/mol. Its IUPAC name is methyl 2-[(5Z)-3-(4-ethylphenyl)-5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-3-(4-ethylphenyl)-5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126067028 |
| Molecular Formula | C28H25FN2O4S |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | methyl 2-[(5Z)-3-(4-ethylphenyl)-5-[[4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3ccc(OCc4ccccc4F)cc3)N(CC(=O)OC)C2=S)cc1 |
| InChI | InChI=1S/C28H25FN2O4S/c1-3-19-8-12-22(13-9-19)31-27(33)25(30(28(31)36)17-26(32)34-2)16-20-10-14-23(15-11-20)35-18-21-6-4-5-7-24(21)29/h4-16H,3,17-18H2,1-2H3/b25-16- |
| InChIKey | RQCBLTDQWLAVAJ-XYGWBWBKSA-N |
| XLogP | 5.11 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|