C20H17NO5 — CID 7504667
3-[(4Z)-4-[(4-methoxyphenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid (PubChem CID 7504667) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 3-[(4Z)-4-[(4-methoxyphenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid.
| Compound Name | 3-[(4Z)-4-[(4-methoxyphenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 7504667 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-[(4Z)-4-[(4-methoxyphenyl)methylidene]-1,3-dioxoisoquinolin-2-yl]propanoic acid |
| SMILES | COc1ccc(/C=C2\C(=O)N(CCC(=O)O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H17NO5/c1-26-14-8-6-13(7-9-14)12-17-15-4-2-3-5-16(15)19(24)21(20(17)25)11-10-18(22)23/h2-9,12H,10-11H2,1H3,(H,22,23)/b17-12- |
| InChIKey | LZGPJZGRBYAXLF-ATVHPVEESA-N |
| XLogP | 2.69 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|