C20H19FN2O3 — CID 5023404
6-(1,3-dioxoisoindol-2-yl)-N-(3-fluorophenyl)hexanamide (PubChem CID 5023404) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-N-(3-fluorophenyl)hexanamide.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-N-(3-fluorophenyl)hexanamide |
|---|---|
| PubChem CID | 5023404 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-N-(3-fluorophenyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H19FN2O3/c21-14-7-6-8-15(13-14)22-18(24)11-2-1-5-12-23-19(25)16-9-3-4-10-17(16)20(23)26/h3-4,6-10,13H,1-2,5,11-12H2,(H,22,24) |
| InChIKey | BYGPIHGODVSFJG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|