C22H18FN3O2S — CID 20948665
N-(3-fluorophenyl)-4-(5-oxopyrido[2,3-b][1,5]benzothiazepin-6-yl)butanamide (PubChem CID 20948665) has the molecular formula C22H18FN3O2S and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-(5-oxopyrido[2,3-b][1,5]benzothiazepin-6-yl)butanamide.
| Compound Name | N-(3-fluorophenyl)-4-(5-oxopyrido[2,3-b][1,5]benzothiazepin-6-yl)butanamide |
|---|---|
| PubChem CID | 20948665 |
| Molecular Formula | C22H18FN3O2S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-(3-fluorophenyl)-4-(5-oxopyrido[2,3-b][1,5]benzothiazepin-6-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2cccnc2Sc2ccccc21)Nc1cccc(F)c1 |
| InChI | InChI=1S/C22H18FN3O2S/c23-15-6-3-7-16(14-15)25-20(27)11-5-13-26-18-9-1-2-10-19(18)29-21-17(22(26)28)8-4-12-24-21/h1-4,6-10,12,14H,5,11,13H2,(H,25,27) |
| InChIKey | FOUZUQFEIRXURM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |